C21H28N2O2S — CID 56746683
3-hydroxy-3-[[methyl(thiophen-2-ylmethyl)amino]methyl]-1-(3-phenylpropyl)piperidin-2-one (PubChem CID 56746683) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is 3-hydroxy-3-[[methyl(thiophen-2-ylmethyl)amino]methyl]-1-(3-phenylpropyl)piperidin-2-one.
| Compound Name | 3-hydroxy-3-[[methyl(thiophen-2-ylmethyl)amino]methyl]-1-(3-phenylpropyl)piperidin-2-one |
|---|---|
| PubChem CID | 56746683 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 3-hydroxy-3-[[methyl(thiophen-2-ylmethyl)amino]methyl]-1-(3-phenylpropyl)piperidin-2-one |
| SMILES | CN(Cc1cccs1)CC1(O)CCCN(CCCc2ccccc2)C1=O |
| InChI | InChI=1S/C21H28N2O2S/c1-22(16-19-11-6-15-26-19)17-21(25)12-7-14-23(20(21)24)13-5-10-18-8-3-2-4-9-18/h2-4,6,8-9,11,15,25H,5,7,10,12-14,16-17H2,1H3 |
| InChIKey | NVBHAHFMNWGNHP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |