C20H29N3O5 — CID 56747307
(2S,4S,5R)-4-(2-acetamidoethylcarbamoyl)-2-ethyl-5-(4-methoxyphenyl)-1-methylpyrrolidine-2-carboxylic acid (PubChem CID 56747307) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is (2S,4S,5R)-4-(2-acetamidoethylcarbamoyl)-2-ethyl-5-(4-methoxyphenyl)-1-methylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S,5R)-4-(2-acetamidoethylcarbamoyl)-2-ethyl-5-(4-methoxyphenyl)-1-methylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 56747307 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (2S,4S,5R)-4-(2-acetamidoethylcarbamoyl)-2-ethyl-5-(4-methoxyphenyl)-1-methylpyrrolidine-2-carboxylic acid |
| SMILES | CC[C@@]1(C(=O)O)C[C@H](C(=O)NCCNC(C)=O)[C@H](c2ccc(OC)cc2)N1C |
| InChI | InChI=1S/C20H29N3O5/c1-5-20(19(26)27)12-16(18(25)22-11-10-21-13(2)24)17(23(20)3)14-6-8-15(28-4)9-7-14/h6-9,16-17H,5,10-12H2,1-4H3,(H,21,24)(H,22,25)(H,26,27)/t16-,17-,20-/m0/s1 |
| InChIKey | HQLKTVVVEVATDG-ZWOKBUDYSA-N |
| XLogP | 1.17 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|