C21H25N5O2 — CID 56747334
[5-(benzimidazol-1-ylmethyl)-1H-pyrazol-3-yl]-(4-methoxy-4-prop-2-enylpiperidin-1-yl)methanone (PubChem CID 56747334) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is [5-(benzimidazol-1-ylmethyl)-1H-pyrazol-3-yl]-(4-methoxy-4-prop-2-enylpiperidin-1-yl)methanone.
| Compound Name | [5-(benzimidazol-1-ylmethyl)-1H-pyrazol-3-yl]-(4-methoxy-4-prop-2-enylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 56747334 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | [5-(benzimidazol-1-ylmethyl)-1H-pyrazol-3-yl]-(4-methoxy-4-prop-2-enylpiperidin-1-yl)methanone |
| SMILES | C=CCC1(OC)CCN(C(=O)c2cc(Cn3cnc4ccccc43)[nH]n2)CC1 |
| InChI | InChI=1S/C21H25N5O2/c1-3-8-21(28-2)9-11-25(12-10-21)20(27)18-13-16(23-24-18)14-26-15-22-17-6-4-5-7-19(17)26/h3-7,13,15H,1,8-12,14H2,2H3,(H,23,24) |
| InChIKey | PVJJBXCJWFKRMN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|