C20H32N2O3 — CID 56747738
[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-[5-(diethylaminomethyl)-2-methylfuran-3-yl]methanone (PubChem CID 56747738) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is [(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-[5-(diethylaminomethyl)-2-methylfuran-3-yl]methanone.
| Compound Name | [(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-[5-(diethylaminomethyl)-2-methylfuran-3-yl]methanone |
|---|---|
| PubChem CID | 56747738 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | [(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-[5-(diethylaminomethyl)-2-methylfuran-3-yl]methanone |
| SMILES | CCN(CC)Cc1cc(C(=O)N2CC[C@@]3(O)CCCC[C@H]3C2)c(C)o1 |
| InChI | InChI=1S/C20H32N2O3/c1-4-21(5-2)14-17-12-18(15(3)25-17)19(23)22-11-10-20(24)9-7-6-8-16(20)13-22/h12,16,24H,4-11,13-14H2,1-3H3/t16-,20-/m0/s1 |
| InChIKey | DOMJLYDDHGYYHI-JXFKEZNVSA-N |
| XLogP | 3.20 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |