C14H20N2O4S2 — CID 56747917
2-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]sulfonyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid (PubChem CID 56747917) has the molecular formula C14H20N2O4S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]sulfonyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid.
| Compound Name | 2-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]sulfonyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 56747917 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]sulfonyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid |
| SMILES | C[C@@H]1CC[C@H](C)N1S(=O)(=O)c1sc2c(c1C(=O)O)CCNC2 |
| InChI | InChI=1S/C14H20N2O4S2/c1-8-3-4-9(2)16(8)22(19,20)14-12(13(17)18)10-5-6-15-7-11(10)21-14/h8-9,15H,3-7H2,1-2H3,(H,17,18)/t8-,9+ |
| InChIKey | YREBUYAIMWOEOA-DTORHVGOSA-N |
| XLogP | 1.65 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |