C19H33N3O4 — CID 56748802
3-[2-[[1-(2-cyclohexylethyl)-3-hydroxy-2-oxopiperidin-3-yl]methylamino]ethyl]-1,3-oxazolidin-2-one (PubChem CID 56748802) has the molecular formula C19H33N3O4 and a molecular weight of 367.49 g/mol. Its IUPAC name is 3-[2-[[1-(2-cyclohexylethyl)-3-hydroxy-2-oxopiperidin-3-yl]methylamino]ethyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[[1-(2-cyclohexylethyl)-3-hydroxy-2-oxopiperidin-3-yl]methylamino]ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 56748802 |
| Molecular Formula | C19H33N3O4 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 3-[2-[[1-(2-cyclohexylethyl)-3-hydroxy-2-oxopiperidin-3-yl]methylamino]ethyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1CCNCC1(O)CCCN(CCC2CCCCC2)C1=O |
| InChI | InChI=1S/C19H33N3O4/c23-17-19(25,15-20-9-12-22-13-14-26-18(22)24)8-4-10-21(17)11-7-16-5-2-1-3-6-16/h16,20,25H,1-15H2 |
| InChIKey | QVOXITSZHPPUMT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|