C14H23N5O3S2 — CID 56749272
N-[5-[[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]sulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 56749272) has the molecular formula C14H23N5O3S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[5-[[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]sulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]sulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 56749272 |
| Molecular Formula | C14H23N5O3S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[5-[[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]sulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(S(=O)(=O)N[C@H]2C[C@H]3CN(C)CCN3C2)s1 |
| InChI | InChI=1S/C14H23N5O3S2/c1-9-13(23-14(15-9)16-10(2)20)24(21,22)17-11-6-12-8-18(3)4-5-19(12)7-11/h11-12,17H,4-8H2,1-3H3,(H,15,16,20)/t11-,12-/m0/s1 |
| InChIKey | KRLJIGCATJLHKF-RYUDHWBXSA-N |
| XLogP | 0.08 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |