C18H23N5 — CID 56749483
4-(3,4-dihydro-1H-isoquinolin-2-yl)-N,N-dimethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine (PubChem CID 56749483) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N,N-dimethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine.
| Compound Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N,N-dimethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 56749483 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N,N-dimethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine |
| SMILES | CN(C)c1nc2c(c(N3CCc4ccccc4C3)n1)CCNC2 |
| InChI | InChI=1S/C18H23N5/c1-22(2)18-20-16-11-19-9-7-15(16)17(21-18)23-10-8-13-5-3-4-6-14(13)12-23/h3-6,19H,7-12H2,1-2H3 |
| InChIKey | OWXQHIVLIMWCAN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |