C10H16N4O2S — CID 56749506
(2R)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]oxolane-2-carboxamide (PubChem CID 56749506) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is (2R)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 56749506 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | (2R)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]oxolane-2-carboxamide |
| SMILES | Cc1nc(SCCNC(=O)[C@H]2CCCO2)n[nH]1 |
| InChI | InChI=1S/C10H16N4O2S/c1-7-12-10(14-13-7)17-6-4-11-9(15)8-3-2-5-16-8/h8H,2-6H2,1H3,(H,11,15)(H,12,13,14)/t8-/m1/s1 |
| InChIKey | XSPLSXWHQUPPQV-MRVPVSSYSA-N |
| XLogP | 0.50 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|