C17H27N5O2 — CID 56749579
N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanamide (PubChem CID 56749579) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanamide.
| Compound Name | N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanamide |
|---|---|
| PubChem CID | 56749579 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanamide |
| SMILES | Cc1cc(C)n(CCC(=O)N[C@H]2C[C@H]3CN(C)CCN3C2)c(=O)n1 |
| InChI | InChI=1S/C17H27N5O2/c1-12-8-13(2)22(17(24)18-12)5-4-16(23)19-14-9-15-11-20(3)6-7-21(15)10-14/h8,14-15H,4-7,9-11H2,1-3H3,(H,19,23)/t14-,15-/m0/s1 |
| InChIKey | NUXXZKTZMMMRBY-GJZGRUSLSA-N |
| XLogP | -0.25 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |