C16H26FN3O2S — CID 56750737
3-[[[ethyl(methyl)sulfamoyl]amino]methyl]-1-[(2-fluorophenyl)methyl]piperidine (PubChem CID 56750737) has the molecular formula C16H26FN3O2S and a molecular weight of 343.47 g/mol. Its IUPAC name is 3-[[[ethyl(methyl)sulfamoyl]amino]methyl]-1-[(2-fluorophenyl)methyl]piperidine.
| Compound Name | 3-[[[ethyl(methyl)sulfamoyl]amino]methyl]-1-[(2-fluorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 56750737 |
| Molecular Formula | C16H26FN3O2S |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 3-[[[ethyl(methyl)sulfamoyl]amino]methyl]-1-[(2-fluorophenyl)methyl]piperidine |
| SMILES | CCN(C)S(=O)(=O)NCC1CCCN(Cc2ccccc2F)C1 |
| InChI | InChI=1S/C16H26FN3O2S/c1-3-19(2)23(21,22)18-11-14-7-6-10-20(12-14)13-15-8-4-5-9-16(15)17/h4-5,8-9,14,18H,3,6-7,10-13H2,1-2H3 |
| InChIKey | KSCVWTSWNMRTSA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |