About 2-oxa-7-thiatricyclo[4.3.1.03,8]decane
2-oxa-7-thiatricyclo[4.3.1.03,8]decane (PubChem CID 567511) has the molecular formula C8H12OS
and a molecular weight of 156.25 g/mol. Its IUPAC name is 2-oxa-7-thiatricyclo[4.3.1.03,8]decane.
Molecular Properties
| Compound Name | 2-oxa-7-thiatricyclo[4.3.1.03,8]decane |
| PubChem CID | 567511 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 2-oxa-7-thiatricyclo[4.3.1.03,8]decane |
| SMILES | C1CC2OC3CC1SC2C3 |
| InChI | InChI=1S/C8H12OS/c1-2-7-8-4-5(9-7)3-6(1)10-8/h5-8H,1-4H2 |
| InChIKey | VRJYLERNJSIGNK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-oxa-7-thiatricyclo[4.3.1.03,8]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxa-7-thiatricyclo[4.3.1.03,8]decane?
The IUPAC name of 2-oxa-7-thiatricyclo[4.3.1.03,8]decane (CID 567511) is 2-oxa-7-thiatricyclo[4.3.1.03,8]decane.
What is the SMILES notation for 2-oxa-7-thiatricyclo[4.3.1.03,8]decane?
The canonical SMILES for 2-oxa-7-thiatricyclo[4.3.1.03,8]decane is C1CC2OC3CC1SC2C3.
What is the InChIKey of 2-oxa-7-thiatricyclo[4.3.1.03,8]decane?
The InChIKey is VRJYLERNJSIGNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12OS/c1-2-7-8-4-5(9-7)3-6(1)10-8/h5-8H,1-4H2.
What are the key properties of 2-oxa-7-thiatricyclo[4.3.1.03,8]decane?
2-oxa-7-thiatricyclo[4.3.1.03,8]decane has a molecular weight of 156.25 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxa-7-thiatricyclo[4.3.1.03,8]decane is sourced from PubChem (CID 567511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).