About [6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone
[6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone (PubChem CID 56752076) has the molecular formula C21H26N4O3
and a molecular weight of 382.46 g/mol. Its IUPAC name is [6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | [6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone |
| PubChem CID | 56752076 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | [6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc(N2CCCOCC2)nc1)N1CCC(Oc2cccnc2)CC1 |
| InChI | InChI=1S/C21H26N4O3/c26-21(17-4-5-20(23-15-17)24-9-2-13-27-14-12-24)25-10-6-18(7-11-25)28-19-3-1-8-22-16-19/h1,3-5,8,15-16,18H,2,6-7,9-14H2 |
| InChIKey | KHWBSILVEMVUJU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone?
The IUPAC name of [6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone (CID 56752076) is [6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone.
What is the SMILES notation for [6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone?
The canonical SMILES for [6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone is O=C(c1ccc(N2CCCOCC2)nc1)N1CCC(Oc2cccnc2)CC1.
What is the InChIKey of [6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone?
The InChIKey is KHWBSILVEMVUJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O3/c26-21(17-4-5-20(23-15-17)24-9-2-13-27-14-12-24)25-10-6-18(7-11-25)28-19-3-1-8-22-16-19/h1,3-5,8,15-16,18H,2,6-7,9-14H2.
What are the key properties of [6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone?
[6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone has a molecular weight of 382.46 g/mol, XLogP of 2.39, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,4-oxazepan-4-yl)-3-pyridinyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone is sourced from PubChem (CID 56752076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).