About [6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone
[6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 56752138) has the molecular formula C17H25N5O
and a molecular weight of 315.42 g/mol. Its IUPAC name is [6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | [6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone |
| PubChem CID | 56752138 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | [6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cncc(N2CCC3(CCCNC3)C2)n1)N1CCCC1 |
| InChI | InChI=1S/C17H25N5O/c23-16(21-7-1-2-8-21)14-10-19-11-15(20-14)22-9-5-17(13-22)4-3-6-18-12-17/h10-11,18H,1-9,12-13H2 |
| InChIKey | DTQFAJRPNBDBKY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone?
The IUPAC name of [6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone (CID 56752138) is [6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone.
What is the SMILES notation for [6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone?
The canonical SMILES for [6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone is O=C(c1cncc(N2CCC3(CCCNC3)C2)n1)N1CCCC1.
What is the InChIKey of [6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone?
The InChIKey is DTQFAJRPNBDBKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N5O/c23-16(21-7-1-2-8-21)14-10-19-11-15(20-14)22-9-5-17(13-22)4-3-6-18-12-17/h10-11,18H,1-9,12-13H2.
What are the key properties of [6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone?
[6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone has a molecular weight of 315.42 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2,9-diazaspiro[4.5]decan-2-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 56752138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).