C15H25ClN4 — CID 56752186
(9aS)-2-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 56752186) has the molecular formula C15H25ClN4 and a molecular weight of 296.85 g/mol. Its IUPAC name is (9aS)-2-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | (9aS)-2-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 56752186 |
| Molecular Formula | C15H25ClN4 |
| Molecular Weight | 296.85 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (9aS)-2-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | CCc1nn(C)c(Cl)c1CN1CCCN2CCC[C@H]2C1 |
| InChI | InChI=1S/C15H25ClN4/c1-3-14-13(15(16)18(2)17-14)11-19-7-5-9-20-8-4-6-12(20)10-19/h12H,3-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | LNNMWFXGEJXUBH-LBPRGKRZSA-N |
| XLogP | 2.31 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.85 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |