About 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol
1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol (PubChem CID 56752569) has the molecular formula C11H20N4O2
and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol |
| PubChem CID | 56752569 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol |
| SMILES | CCn1ncnc1CN1CCC(O)(CO)CC1 |
| InChI | InChI=1S/C11H20N4O2/c1-2-15-10(12-9-13-15)7-14-5-3-11(17,8-16)4-6-14/h9,16-17H,2-8H2,1H3 |
| InChIKey | BSYIWQCFNPZQFN-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol?
The IUPAC name of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol (CID 56752569) is 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol.
What is the SMILES notation for 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol?
The canonical SMILES for 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol is CCn1ncnc1CN1CCC(O)(CO)CC1.
What is the InChIKey of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol?
The InChIKey is BSYIWQCFNPZQFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O2/c1-2-15-10(12-9-13-15)7-14-5-3-11(17,8-16)4-6-14/h9,16-17H,2-8H2,1H3.
What are the key properties of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol?
1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol has a molecular weight of 240.31 g/mol, XLogP of -0.38, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-(hydroxymethyl)piperidin-4-ol is sourced from PubChem (CID 56752569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).