C16H27N3O3 — CID 56752959
1-[3-(4-ethyl-2-methyl-3-oxopiperazin-1-yl)-3-oxopropyl]azepan-2-one (PubChem CID 56752959) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-[3-(4-ethyl-2-methyl-3-oxopiperazin-1-yl)-3-oxopropyl]azepan-2-one.
| Compound Name | 1-[3-(4-ethyl-2-methyl-3-oxopiperazin-1-yl)-3-oxopropyl]azepan-2-one |
|---|---|
| PubChem CID | 56752959 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 1-[3-(4-ethyl-2-methyl-3-oxopiperazin-1-yl)-3-oxopropyl]azepan-2-one |
| SMILES | CCN1CCN(C(=O)CCN2CCCCCC2=O)C(C)C1=O |
| InChI | InChI=1S/C16H27N3O3/c1-3-17-11-12-19(13(2)16(17)22)15(21)8-10-18-9-6-4-5-7-14(18)20/h13H,3-12H2,1-2H3 |
| InChIKey | XPAUCFOOGLIBDZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |