C15H20N2OS — CID 56753082
(1R,2R,4R)-N-[(2-propyl-1,3-thiazol-4-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 56753082) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is (1R,2R,4R)-N-[(2-propyl-1,3-thiazol-4-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4R)-N-[(2-propyl-1,3-thiazol-4-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 56753082 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (1R,2R,4R)-N-[(2-propyl-1,3-thiazol-4-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CCCc1nc(CNC(=O)[C@@H]2C[C@@H]3C=C[C@H]2C3)cs1 |
| InChI | InChI=1S/C15H20N2OS/c1-2-3-14-17-12(9-19-14)8-16-15(18)13-7-10-4-5-11(13)6-10/h4-5,9-11,13H,2-3,6-8H2,1H3,(H,16,18)/t10-,11+,13-/m1/s1 |
| InChIKey | KRJPSESNCOCZJI-NTZNESFSSA-N |
| XLogP | 2.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|