C21H31N3O3 — CID 56753563
3-methyl-1-[1-[6-(oxan-4-ylamino)pyridine-3-carbonyl]piperidin-3-yl]butan-1-one (PubChem CID 56753563) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 3-methyl-1-[1-[6-(oxan-4-ylamino)pyridine-3-carbonyl]piperidin-3-yl]butan-1-one.
| Compound Name | 3-methyl-1-[1-[6-(oxan-4-ylamino)pyridine-3-carbonyl]piperidin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 56753563 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 3-methyl-1-[1-[6-(oxan-4-ylamino)pyridine-3-carbonyl]piperidin-3-yl]butan-1-one |
| SMILES | CC(C)CC(=O)C1CCCN(C(=O)c2ccc(NC3CCOCC3)nc2)C1 |
| InChI | InChI=1S/C21H31N3O3/c1-15(2)12-19(25)17-4-3-9-24(14-17)21(26)16-5-6-20(22-13-16)23-18-7-10-27-11-8-18/h5-6,13,15,17-18H,3-4,7-12,14H2,1-2H3,(H,22,23) |
| InChIKey | AWXBPJRGSRZHHW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |