C17H15N5S — CID 56753912
2-[2-[2-[5-(1H-pyrazol-5-yl)thiophen-2-yl]imidazol-1-yl]ethyl]pyridine (PubChem CID 56753912) has the molecular formula C17H15N5S and a molecular weight of 321.41 g/mol. Its IUPAC name is 2-[2-[2-[5-(1H-pyrazol-5-yl)thiophen-2-yl]imidazol-1-yl]ethyl]pyridine.
| Compound Name | 2-[2-[2-[5-(1H-pyrazol-5-yl)thiophen-2-yl]imidazol-1-yl]ethyl]pyridine |
|---|---|
| PubChem CID | 56753912 |
| Molecular Formula | C17H15N5S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-[2-[2-[5-(1H-pyrazol-5-yl)thiophen-2-yl]imidazol-1-yl]ethyl]pyridine |
| SMILES | c1ccc(CCn2ccnc2-c2ccc(-c3ccn[nH]3)s2)nc1 |
| InChI | InChI=1S/C17H15N5S/c1-2-8-18-13(3-1)7-11-22-12-10-19-17(22)16-5-4-15(23-16)14-6-9-20-21-14/h1-6,8-10,12H,7,11H2,(H,20,21) |
| InChIKey | CVIRUPULSIVAEQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |