C18H27N3OS — CID 56754023
3-[5-[(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)methyl]thiophen-3-yl]prop-2-yn-1-ol (PubChem CID 56754023) has the molecular formula C18H27N3OS and a molecular weight of 333.50 g/mol. Its IUPAC name is 3-[5-[(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)methyl]thiophen-3-yl]prop-2-yn-1-ol.
| Compound Name | 3-[5-[(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)methyl]thiophen-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 56754023 |
| Molecular Formula | C18H27N3OS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 3-[5-[(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)methyl]thiophen-3-yl]prop-2-yn-1-ol |
| SMILES | CN1CCN(C)C2(CCN(Cc3cc(C#CCO)cs3)CC2)C1 |
| InChI | InChI=1S/C18H27N3OS/c1-19-9-10-20(2)18(15-19)5-7-21(8-6-18)13-17-12-16(14-23-17)4-3-11-22/h12,14,22H,5-11,13,15H2,1-2H3 |
| InChIKey | XGANOMGQRPUUCA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|