C17H13F3N4 — CID 56754024
5-amino-3-(2,3,5-trifluorophenyl)-1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-4-carbonitrile (PubChem CID 56754024) has the molecular formula C17H13F3N4 and a molecular weight of 330.31 g/mol. Its IUPAC name is 5-amino-3-(2,3,5-trifluorophenyl)-1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-4-carbonitrile.
| Compound Name | 5-amino-3-(2,3,5-trifluorophenyl)-1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-4-carbonitrile |
|---|---|
| PubChem CID | 56754024 |
| Molecular Formula | C17H13F3N4 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 5-amino-3-(2,3,5-trifluorophenyl)-1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-4-carbonitrile |
| SMILES | N#Cc1c(N)nc2c(c1-c1cc(F)cc(F)c1F)N1CCC2CC1 |
| InChI | InChI=1S/C17H13F3N4/c18-9-5-10(14(20)12(19)6-9)13-11(7-21)17(22)23-15-8-1-3-24(4-2-8)16(13)15/h5-6,8H,1-4H2,(H2,22,23) |
| InChIKey | FYZFONJMRHPXTL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|