C20H28N4O — CID 56754248
5-(1-cyclohexylpiperidin-3-yl)-2-methyl-4-phenyl-1,2,4-triazol-3-one (PubChem CID 56754248) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 5-(1-cyclohexylpiperidin-3-yl)-2-methyl-4-phenyl-1,2,4-triazol-3-one.
| Compound Name | 5-(1-cyclohexylpiperidin-3-yl)-2-methyl-4-phenyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 56754248 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 5-(1-cyclohexylpiperidin-3-yl)-2-methyl-4-phenyl-1,2,4-triazol-3-one |
| SMILES | Cn1nc(C2CCCN(C3CCCCC3)C2)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C20H28N4O/c1-22-20(25)24(18-12-6-3-7-13-18)19(21-22)16-9-8-14-23(15-16)17-10-4-2-5-11-17/h3,6-7,12-13,16-17H,2,4-5,8-11,14-15H2,1H3 |
| InChIKey | ZKILKYKQBPXANR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |