C20H17N3O5 — CID 56754424
[3-(1,3-benzodioxol-5-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-(2,6-dihydroxyphenyl)methanone (PubChem CID 56754424) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is [3-(1,3-benzodioxol-5-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-(2,6-dihydroxyphenyl)methanone.
| Compound Name | [3-(1,3-benzodioxol-5-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-(2,6-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 56754424 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [3-(1,3-benzodioxol-5-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-(2,6-dihydroxyphenyl)methanone |
| SMILES | O=C(c1c(O)cccc1O)N1CCc2[nH]nc(-c3ccc4c(c3)OCO4)c2C1 |
| InChI | InChI=1S/C20H17N3O5/c24-14-2-1-3-15(25)18(14)20(26)23-7-6-13-12(9-23)19(22-21-13)11-4-5-16-17(8-11)28-10-27-16/h1-5,8,24-25H,6-7,9-10H2,(H,21,22) |
| InChIKey | YOCYWTOVIIHEAP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 107.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |