About [3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone
[3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone (PubChem CID 56754467) has the molecular formula C17H23N5OS
and a molecular weight of 345.47 g/mol. Its IUPAC name is [3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone.
Molecular Properties
| Compound Name | [3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone |
| PubChem CID | 56754467 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1cnc(CN2CCCC2)s1)N1CCCC(c2ccn[nH]2)C1 |
| InChI | InChI=1S/C17H23N5OS/c23-17(15-10-18-16(24-15)12-21-7-1-2-8-21)22-9-3-4-13(11-22)14-5-6-19-20-14/h5-6,10,13H,1-4,7-9,11-12H2,(H,19,20) |
| InChIKey | NBPRWPAKRITGCH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone?
The IUPAC name of [3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone (CID 56754467) is [3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone.
What is the SMILES notation for [3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone?
The canonical SMILES for [3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone is O=C(c1cnc(CN2CCCC2)s1)N1CCCC(c2ccn[nH]2)C1.
What is the InChIKey of [3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone?
The InChIKey is NBPRWPAKRITGCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N5OS/c23-17(15-10-18-16(24-15)12-21-7-1-2-8-21)22-9-3-4-13(11-22)14-5-6-19-20-14/h5-6,10,13H,1-4,7-9,11-12H2,(H,19,20).
What are the key properties of [3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone?
[3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone has a molecular weight of 345.47 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1H-pyrazol-5-yl)piperidin-1-yl]-[2-(pyrrolidin-1-ylmethyl)-1,3-thiazol-5-yl]methanone is sourced from PubChem (CID 56754467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).