About 7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane
7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane (PubChem CID 56754640) has the molecular formula C17H24N2O3
and a molecular weight of 304.39 g/mol. Its IUPAC name is 7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane |
| PubChem CID | 56754640 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane |
| SMILES | COc1cc2c(cc1CN1CCCC3(CCNC3)C1)OCO2 |
| InChI | InChI=1S/C17H24N2O3/c1-20-14-8-16-15(21-12-22-16)7-13(14)9-19-6-2-3-17(11-19)4-5-18-10-17/h7-8,18H,2-6,9-12H2,1H3 |
| InChIKey | SSCNTSKPLREFRU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane?
The IUPAC name of 7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane (CID 56754640) is 7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane.
What is the SMILES notation for 7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane?
The canonical SMILES for 7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane is COc1cc2c(cc1CN1CCCC3(CCNC3)C1)OCO2.
What is the InChIKey of 7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane?
The InChIKey is SSCNTSKPLREFRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O3/c1-20-14-8-16-15(21-12-22-16)7-13(14)9-19-6-2-3-17(11-19)4-5-18-10-17/h7-8,18H,2-6,9-12H2,1H3.
What are the key properties of 7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane?
7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane has a molecular weight of 304.39 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]-2,7-diazaspiro[4.5]decane is sourced from PubChem (CID 56754640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).