C22H22ClN3O2 — CID 56754859
7-(3-chlorophenyl)-4-[(1-prop-2-enylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepin-9-ol (PubChem CID 56754859) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-4-[(1-prop-2-enylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepin-9-ol.
| Compound Name | 7-(3-chlorophenyl)-4-[(1-prop-2-enylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepin-9-ol |
|---|---|
| PubChem CID | 56754859 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 7-(3-chlorophenyl)-4-[(1-prop-2-enylpyrazol-4-yl)methyl]-3,5-dihydro-2H-1,4-benzoxazepin-9-ol |
| SMILES | C=CCn1cc(CN2CCOc3c(O)cc(-c4cccc(Cl)c4)cc3C2)cn1 |
| InChI | InChI=1S/C22H22ClN3O2/c1-2-6-26-14-16(12-24-26)13-25-7-8-28-22-19(15-25)9-18(11-21(22)27)17-4-3-5-20(23)10-17/h2-5,9-12,14,27H,1,6-8,13,15H2 |
| InChIKey | VWIWQKROHCNNOC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|