About [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone
[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone (PubChem CID 56755169) has the molecular formula C14H17N5OS
and a molecular weight of 303.39 g/mol. Its IUPAC name is [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone.
Molecular Properties
| Compound Name | [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone |
| PubChem CID | 56755169 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1Cc2cnc(CC(C)C)nc2C1 |
| InChI | InChI=1S/C14H17N5OS/c1-8(2)4-12-15-5-10-6-19(7-11(10)16-12)14(20)13-9(3)17-18-21-13/h5,8H,4,6-7H2,1-3H3 |
| InChIKey | QSMOEGUYMRZVGW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 71.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone?
The IUPAC name of [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone (CID 56755169) is [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone.
What is the SMILES notation for [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone?
The canonical SMILES for [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone is Cc1nnsc1C(=O)N1Cc2cnc(CC(C)C)nc2C1.
What is the InChIKey of [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone?
The InChIKey is QSMOEGUYMRZVGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5OS/c1-8(2)4-12-15-5-10-6-19(7-11(10)16-12)14(20)13-9(3)17-18-21-13/h5,8H,4,6-7H2,1-3H3.
What are the key properties of [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone?
[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone has a molecular weight of 303.39 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(4-methylthiadiazol-5-yl)methanone is sourced from PubChem (CID 56755169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).