C18H27N7O2 — CID 56755836
2-[2-(1,9-dimethyl-1,4,9-triazaspiro[5.5]undecan-4-yl)-2-oxoethyl]-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 56755836) has the molecular formula C18H27N7O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-[2-(1,9-dimethyl-1,4,9-triazaspiro[5.5]undecan-4-yl)-2-oxoethyl]-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2-[2-(1,9-dimethyl-1,4,9-triazaspiro[5.5]undecan-4-yl)-2-oxoethyl]-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 56755836 |
| Molecular Formula | C18H27N7O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2-[2-(1,9-dimethyl-1,4,9-triazaspiro[5.5]undecan-4-yl)-2-oxoethyl]-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n2[nH]c(CC(=O)N3CCN(C)C4(CCN(C)CC4)C3)nc2n1 |
| InChI | InChI=1S/C18H27N7O2/c1-13-10-16(27)25-17(19-13)20-14(21-25)11-15(26)24-9-8-23(3)18(12-24)4-6-22(2)7-5-18/h10H,4-9,11-12H2,1-3H3,(H,19,20,21) |
| InChIKey | GJQGSYUDNHRURO-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |