C23H34O4 — CID 567560
8'-(3-hydroxypropyl)-1',1',4'a,7'-tetramethylspiro[1,3-dioxolane-2,2'-3,4,4b,5,8,8a-hexahydrophenanthrene]-9'-one (PubChem CID 567560) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is 8'-(3-hydroxypropyl)-1',1',4'a,7'-tetramethylspiro[1,3-dioxolane-2,2'-3,4,4b,5,8,8a-hexahydrophenanthrene]-9'-one.
| Compound Name | 8'-(3-hydroxypropyl)-1',1',4'a,7'-tetramethylspiro[1,3-dioxolane-2,2'-3,4,4b,5,8,8a-hexahydrophenanthrene]-9'-one |
|---|---|
| PubChem CID | 567560 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 8'-(3-hydroxypropyl)-1',1',4'a,7'-tetramethylspiro[1,3-dioxolane-2,2'-3,4,4b,5,8,8a-hexahydrophenanthrene]-9'-one |
| SMILES | CC1=CCC2C(C(=O)C=C3C2(C)CCC2(OCCO2)C3(C)C)C1CCCO |
| InChI | InChI=1S/C23H34O4/c1-15-7-8-17-20(16(15)6-5-11-24)18(25)14-19-21(2,3)23(26-12-13-27-23)10-9-22(17,19)4/h7,14,16-17,20,24H,5-6,8-13H2,1-4H3 |
| InChIKey | DUUFTFJKVMUODB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|