C20H27N3O3 — CID 56756848
(1R,4S)-1,7,7-trimethyl-4-[4-(3-methyl-2-pyridinyl)piperazine-1-carbonyl]-2-oxabicyclo[2.2.1]heptan-3-one (PubChem CID 56756848) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is (1R,4S)-1,7,7-trimethyl-4-[4-(3-methyl-2-pyridinyl)piperazine-1-carbonyl]-2-oxabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1R,4S)-1,7,7-trimethyl-4-[4-(3-methyl-2-pyridinyl)piperazine-1-carbonyl]-2-oxabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 56756848 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (1R,4S)-1,7,7-trimethyl-4-[4-(3-methyl-2-pyridinyl)piperazine-1-carbonyl]-2-oxabicyclo[2.2.1]heptan-3-one |
| SMILES | Cc1cccnc1N1CCN(C(=O)[C@@]23CC[C@@](C)(OC2=O)C3(C)C)CC1 |
| InChI | InChI=1S/C20H27N3O3/c1-14-6-5-9-21-15(14)22-10-12-23(13-11-22)16(24)20-8-7-19(4,18(20,2)3)26-17(20)25/h5-6,9H,7-8,10-13H2,1-4H3/t19-,20+/m1/s1 |
| InChIKey | LABCLTJRKAYIIW-UXHICEINSA-N |
| XLogP | 2.16 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|