C17H15F2N5O2 — CID 56757047
6-[[3-(3,4-difluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methyl]-1H-pyrimidine-2,4-dione (PubChem CID 56757047) has the molecular formula C17H15F2N5O2 and a molecular weight of 359.34 g/mol. Its IUPAC name is 6-[[3-(3,4-difluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[[3-(3,4-difluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 56757047 |
| Molecular Formula | C17H15F2N5O2 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 6-[[3-(3,4-difluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(CN2CCc3[nH]nc(-c4ccc(F)c(F)c4)c3C2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C17H15F2N5O2/c18-12-2-1-9(5-13(12)19)16-11-8-24(4-3-14(11)22-23-16)7-10-6-15(25)21-17(26)20-10/h1-2,5-6H,3-4,7-8H2,(H,22,23)(H2,20,21,25,26) |
| InChIKey | OHHQYZMGYNFDLJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |