C15H21N5O3S — CID 56757396
N-[(7S,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]-2-[(dimethylamino)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 56757396) has the molecular formula C15H21N5O3S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-[(7S,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]-2-[(dimethylamino)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(7S,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]-2-[(dimethylamino)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 56757396 |
| Molecular Formula | C15H21N5O3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-[(7S,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]-2-[(dimethylamino)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)Cc1nc(C(=O)N[C@H]2C[C@H]3C(=O)N(C)CC(=O)N3C2)cs1 |
| InChI | InChI=1S/C15H21N5O3S/c1-18(2)6-12-17-10(8-24-12)14(22)16-9-4-11-15(23)19(3)7-13(21)20(11)5-9/h8-9,11H,4-7H2,1-3H3,(H,16,22)/t9-,11-/m0/s1 |
| InChIKey | WWPMSKIEZSUBOU-ONGXEEELSA-N |
| XLogP | -0.62 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |