C23H27N3O2 — CID 56758093
[4-hydroxy-4-(5-methyl-2-pyridinyl)piperidin-1-yl]-(1,3,7-trimethylindol-2-yl)methanone (PubChem CID 56758093) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is [4-hydroxy-4-(5-methyl-2-pyridinyl)piperidin-1-yl]-(1,3,7-trimethylindol-2-yl)methanone.
| Compound Name | [4-hydroxy-4-(5-methyl-2-pyridinyl)piperidin-1-yl]-(1,3,7-trimethylindol-2-yl)methanone |
|---|---|
| PubChem CID | 56758093 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | [4-hydroxy-4-(5-methyl-2-pyridinyl)piperidin-1-yl]-(1,3,7-trimethylindol-2-yl)methanone |
| SMILES | Cc1ccc(C2(O)CCN(C(=O)c3c(C)c4cccc(C)c4n3C)CC2)nc1 |
| InChI | InChI=1S/C23H27N3O2/c1-15-8-9-19(24-14-15)23(28)10-12-26(13-11-23)22(27)21-17(3)18-7-5-6-16(2)20(18)25(21)4/h5-9,14,28H,10-13H2,1-4H3 |
| InChIKey | XAONIXNEQMTBPF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|