C21H25FN4O — CID 56758133
N-[[1-(3-fluorophenyl)-3-(5-methylfuran-2-yl)pyrazol-4-yl]methyl]-2-pyrrolidin-1-ylethanamine (PubChem CID 56758133) has the molecular formula C21H25FN4O and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[[1-(3-fluorophenyl)-3-(5-methylfuran-2-yl)pyrazol-4-yl]methyl]-2-pyrrolidin-1-ylethanamine.
| Compound Name | N-[[1-(3-fluorophenyl)-3-(5-methylfuran-2-yl)pyrazol-4-yl]methyl]-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 56758133 |
| Molecular Formula | C21H25FN4O |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-[[1-(3-fluorophenyl)-3-(5-methylfuran-2-yl)pyrazol-4-yl]methyl]-2-pyrrolidin-1-ylethanamine |
| SMILES | Cc1ccc(-c2nn(-c3cccc(F)c3)cc2CNCCN2CCCC2)o1 |
| InChI | InChI=1S/C21H25FN4O/c1-16-7-8-20(27-16)21-17(14-23-9-12-25-10-2-3-11-25)15-26(24-21)19-6-4-5-18(22)13-19/h4-8,13,15,23H,2-3,9-12,14H2,1H3 |
| InChIKey | YQFDQBGCKYHJTK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|