C19H14F3N3O3 — CID 56758347
3-hydroxy-N-[[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]pyridine-2-carboxamide (PubChem CID 56758347) has the molecular formula C19H14F3N3O3 and a molecular weight of 389.33 g/mol. Its IUPAC name is 3-hydroxy-N-[[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]pyridine-2-carboxamide.
| Compound Name | 3-hydroxy-N-[[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 56758347 |
| Molecular Formula | C19H14F3N3O3 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 3-hydroxy-N-[[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]pyridine-2-carboxamide |
| SMILES | O=C(NCc1cccnc1Oc1cccc(C(F)(F)F)c1)c1ncccc1O |
| InChI | InChI=1S/C19H14F3N3O3/c20-19(21,22)13-5-1-6-14(10-13)28-18-12(4-2-9-24-18)11-25-17(27)16-15(26)7-3-8-23-16/h1-10,26H,11H2,(H,25,27) |
| InChIKey | OVHYQDWGUSMERY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |