C15H21N3O3S — CID 56758862
N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxamide (PubChem CID 56758862) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxamide.
| Compound Name | N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxamide |
|---|---|
| PubChem CID | 56758862 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxamide |
| SMILES | CN1CCN2C[C@@H](NC(=O)c3scc4c3OCCO4)C[C@H]2C1 |
| InChI | InChI=1S/C15H21N3O3S/c1-17-2-3-18-7-10(6-11(18)8-17)16-15(19)14-13-12(9-22-14)20-4-5-21-13/h9-11H,2-8H2,1H3,(H,16,19)/t10-,11-/m0/s1 |
| InChIKey | UVYFTXJZRZWTCX-QWRGUYRKSA-N |
| XLogP | 0.64 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |