About (2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone
(2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone (PubChem CID 56759251) has the molecular formula C14H22N4O
and a molecular weight of 262.36 g/mol. Its IUPAC name is (2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone.
Molecular Properties
| Compound Name | (2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone |
| PubChem CID | 56759251 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCCC3(CCN(C)C3)C2)n[nH]1 |
| InChI | InChI=1S/C14H22N4O/c1-11-8-12(16-15-11)13(19)18-6-3-4-14(10-18)5-7-17(2)9-14/h8H,3-7,9-10H2,1-2H3,(H,15,16) |
| InChIKey | LFCFVGZVEXKVNF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone?
The IUPAC name of (2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone (CID 56759251) is (2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone.
What is the SMILES notation for (2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone?
The canonical SMILES for (2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone is Cc1cc(C(=O)N2CCCC3(CCN(C)C3)C2)n[nH]1.
What is the InChIKey of (2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone?
The InChIKey is LFCFVGZVEXKVNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O/c1-11-8-12(16-15-11)13(19)18-6-3-4-14(10-18)5-7-17(2)9-14/h8H,3-7,9-10H2,1-2H3,(H,15,16).
What are the key properties of (2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone?
(2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone has a molecular weight of 262.36 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2,7-diazaspiro[4.5]decan-7-yl)-(5-methyl-1H-pyrazol-3-yl)methanone is sourced from PubChem (CID 56759251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).