C17H30N4O3 — CID 56759513
4-[2-[2-(2-morpholin-4-ylethyl)piperidin-1-yl]-2-oxoethyl]piperazin-2-one (PubChem CID 56759513) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-[2-[2-(2-morpholin-4-ylethyl)piperidin-1-yl]-2-oxoethyl]piperazin-2-one.
| Compound Name | 4-[2-[2-(2-morpholin-4-ylethyl)piperidin-1-yl]-2-oxoethyl]piperazin-2-one |
|---|---|
| PubChem CID | 56759513 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 4-[2-[2-(2-morpholin-4-ylethyl)piperidin-1-yl]-2-oxoethyl]piperazin-2-one |
| SMILES | O=C1CN(CC(=O)N2CCCCC2CCN2CCOCC2)CCN1 |
| InChI | InChI=1S/C17H30N4O3/c22-16-13-20(8-5-18-16)14-17(23)21-6-2-1-3-15(21)4-7-19-9-11-24-12-10-19/h15H,1-14H2,(H,18,22) |
| InChIKey | FHPLRIZEIVWERU-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |