C15H22N6O — CID 56759551
N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-1-methylimidazo[2,1-e]pyrazole-7-carboxamide (PubChem CID 56759551) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-1-methylimidazo[2,1-e]pyrazole-7-carboxamide.
| Compound Name | N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-1-methylimidazo[2,1-e]pyrazole-7-carboxamide |
|---|---|
| PubChem CID | 56759551 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-1-methylimidazo[2,1-e]pyrazole-7-carboxamide |
| SMILES | CN1CCN2C[C@@H](NC(=O)c3cnn4ccn(C)c34)C[C@H]2C1 |
| InChI | InChI=1S/C15H22N6O/c1-18-3-5-20-9-11(7-12(20)10-18)17-14(22)13-8-16-21-6-4-19(2)15(13)21/h4,6,8,11-12H,3,5,7,9-10H2,1-2H3,(H,17,22)/t11-,12-/m0/s1 |
| InChIKey | GMVIFKZIGWUXKF-RYUDHWBXSA-N |
| XLogP | -0.21 |
| TPSA | 57.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |