About 7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol
7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol (PubChem CID 56759553) has the molecular formula C22H22N2O2
and a molecular weight of 346.43 g/mol. Its IUPAC name is 7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol.
Molecular Properties
| Compound Name | 7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol |
| PubChem CID | 56759553 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol |
| SMILES | Cc1ccccc1-c1cc(O)c2c(c1)CN(Cc1cccnc1)CCO2 |
| InChI | InChI=1S/C22H22N2O2/c1-16-5-2-3-7-20(16)18-11-19-15-24(14-17-6-4-8-23-13-17)9-10-26-22(19)21(25)12-18/h2-8,11-13,25H,9-10,14-15H2,1H3 |
| InChIKey | NVTIHOVGVMNBDK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol?
The IUPAC name of 7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol (CID 56759553) is 7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol.
What is the SMILES notation for 7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol?
The canonical SMILES for 7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol is Cc1ccccc1-c1cc(O)c2c(c1)CN(Cc1cccnc1)CCO2.
What is the InChIKey of 7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol?
The InChIKey is NVTIHOVGVMNBDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O2/c1-16-5-2-3-7-20(16)18-11-19-15-24(14-17-6-4-8-23-13-17)9-10-26-22(19)21(25)12-18/h2-8,11-13,25H,9-10,14-15H2,1H3.
What are the key properties of 7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol?
7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol has a molecular weight of 346.43 g/mol, XLogP of 4.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-methylphenyl)-4-(pyridin-3-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol is sourced from PubChem (CID 56759553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).