About 1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one
1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one (PubChem CID 56760575) has the molecular formula C17H26N2O3
and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one.
Molecular Properties
| Compound Name | 1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one |
| PubChem CID | 56760575 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one |
| SMILES | CC[C@H]1CN(C(=O)CCn2c(C)cccc2=O)CC[C@@]1(C)O |
| InChI | InChI=1S/C17H26N2O3/c1-4-14-12-18(11-9-17(14,3)22)15(20)8-10-19-13(2)6-5-7-16(19)21/h5-7,14,22H,4,8-12H2,1-3H3/t14-,17+/m0/s1 |
| InChIKey | ASZFJXDCCNCKNR-WMLDXEAASA-N |
| XLogP | 1.56 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one?
The IUPAC name of 1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one (CID 56760575) is 1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one.
What is the SMILES notation for 1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one?
The canonical SMILES for 1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one is CC[C@H]1CN(C(=O)CCn2c(C)cccc2=O)CC[C@@]1(C)O.
What is the InChIKey of 1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one?
The InChIKey is ASZFJXDCCNCKNR-WMLDXEAASA-N. The full InChI is InChI=1S/C17H26N2O3/c1-4-14-12-18(11-9-17(14,3)22)15(20)8-10-19-13(2)6-5-7-16(19)21/h5-7,14,22H,4,8-12H2,1-3H3/t14-,17+/m0/s1.
What are the key properties of 1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one?
1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one has a molecular weight of 306.41 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(3S,4R)-3-ethyl-4-hydroxy-4-methylpiperidin-1-yl]-3-oxopropyl]-6-methylpyridin-2-one is sourced from PubChem (CID 56760575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).