C16H14N2O4S — CID 56761334
4-[2-(3-hydroxyphenyl)imino-3-methyl-1,3-thiazol-4-yl]benzene-1,2,3-triol (PubChem CID 56761334) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is 4-[2-(3-hydroxyphenyl)imino-3-methyl-1,3-thiazol-4-yl]benzene-1,2,3-triol.
| Compound Name | 4-[2-(3-hydroxyphenyl)imino-3-methyl-1,3-thiazol-4-yl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 56761334 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 4-[2-(3-hydroxyphenyl)imino-3-methyl-1,3-thiazol-4-yl]benzene-1,2,3-triol |
| SMILES | Cn1c(-c2ccc(O)c(O)c2O)cs/c1=N\c1cccc(O)c1 |
| InChI | InChI=1S/C16H14N2O4S/c1-18-12(11-5-6-13(20)15(22)14(11)21)8-23-16(18)17-9-3-2-4-10(19)7-9/h2-8,19-22H,1H3/b17-16- |
| InChIKey | WODMFHUDUVTPCG-MSUUIHNZSA-N |
| XLogP | 2.81 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|