C18H13FN4OS — CID 56762301
2-(6-fluoroindol-1-yl)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 56762301) has the molecular formula C18H13FN4OS and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-(6-fluoroindol-1-yl)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(6-fluoroindol-1-yl)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 56762301 |
| Molecular Formula | C18H13FN4OS |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 2-(6-fluoroindol-1-yl)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Cn1ccc2ccc(F)cc21)Nc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C18H13FN4OS/c19-13-5-4-12-6-8-23(16(12)9-13)10-17(24)22-18-21-15(11-25-18)14-3-1-2-7-20-14/h1-9,11H,10H2,(H,21,22,24) |
| InChIKey | FFDIHZNMAZHFED-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |