C22H18F3N3O2 — CID 56762401
(1-methylindol-5-yl)-[8-(trifluoromethoxy)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]methanone (PubChem CID 56762401) has the molecular formula C22H18F3N3O2 and a molecular weight of 413.40 g/mol. Its IUPAC name is (1-methylindol-5-yl)-[8-(trifluoromethoxy)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]methanone.
| Compound Name | (1-methylindol-5-yl)-[8-(trifluoromethoxy)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 56762401 |
| Molecular Formula | C22H18F3N3O2 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (1-methylindol-5-yl)-[8-(trifluoromethoxy)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]methanone |
| SMILES | Cn1ccc2cc(C(=O)N3CCc4[nH]c5ccc(OC(F)(F)F)cc5c4C3)ccc21 |
| InChI | InChI=1S/C22H18F3N3O2/c1-27-8-6-13-10-14(2-5-20(13)27)21(29)28-9-7-19-17(12-28)16-11-15(30-22(23,24)25)3-4-18(16)26-19/h2-6,8,10-11,26H,7,9,12H2,1H3 |
| InChIKey | HIACLQHSLVTRBK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|