About 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride
5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride (PubChem CID 56763135) has the molecular formula C3H8ClN5
and a molecular weight of 149.59 g/mol. Its IUPAC name is 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride |
| PubChem CID | 56763135 |
| Molecular Formula | C3H8ClN5 |
| Molecular Weight | 149.59 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride |
| SMILES | Cl.NCc1nc(N)n[nH]1 |
| InChI | InChI=1S/C3H7N5.ClH/c4-1-2-6-3(5)8-7-2;/h1,4H2,(H3,5,6,7,8);1H |
| InChIKey | QLCNXRNCRBCZSY-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.59 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride?
The IUPAC name of 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride (CID 56763135) is 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride.
What is the SMILES notation for 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride?
The canonical SMILES for 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride is Cl.NCc1nc(N)n[nH]1.
What is the InChIKey of 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride?
The InChIKey is QLCNXRNCRBCZSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N5.ClH/c4-1-2-6-3(5)8-7-2;/h1,4H2,(H3,5,6,7,8);1H.
What are the key properties of 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride?
5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride has a molecular weight of 149.59 g/mol, XLogP of -0.73, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;hydrochloride is sourced from PubChem (CID 56763135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).