About 2-propylpiperidin-3-ol
2-propylpiperidin-3-ol (PubChem CID 567632) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-propylpiperidin-3-ol.
Molecular Properties
| Compound Name | 2-propylpiperidin-3-ol |
| PubChem CID | 567632 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-propylpiperidin-3-ol |
| SMILES | CCCC1NCCCC1O |
| InChI | InChI=1S/C8H17NO/c1-2-4-7-8(10)5-3-6-9-7/h7-10H,2-6H2,1H3 |
| InChIKey | NLEHVHSNPPSXBS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propylpiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylpiperidin-3-ol?
The IUPAC name of 2-propylpiperidin-3-ol (CID 567632) is 2-propylpiperidin-3-ol.
What is the SMILES notation for 2-propylpiperidin-3-ol?
The canonical SMILES for 2-propylpiperidin-3-ol is CCCC1NCCCC1O.
What is the InChIKey of 2-propylpiperidin-3-ol?
The InChIKey is NLEHVHSNPPSXBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-2-4-7-8(10)5-3-6-9-7/h7-10H,2-6H2,1H3.
What are the key properties of 2-propylpiperidin-3-ol?
2-propylpiperidin-3-ol has a molecular weight of 143.23 g/mol, XLogP of 0.90, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylpiperidin-3-ol is sourced from PubChem (CID 567632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).