C16H16N4O4 — CID 56763357
3-[[3-[2-(dimethylamino)-2-oxoethyl]phenyl]carbamoyl]pyrazine-2-carboxylic acid (PubChem CID 56763357) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is 3-[[3-[2-(dimethylamino)-2-oxoethyl]phenyl]carbamoyl]pyrazine-2-carboxylic acid.
| Compound Name | 3-[[3-[2-(dimethylamino)-2-oxoethyl]phenyl]carbamoyl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 56763357 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 3-[[3-[2-(dimethylamino)-2-oxoethyl]phenyl]carbamoyl]pyrazine-2-carboxylic acid |
| SMILES | CN(C)C(=O)Cc1cccc(NC(=O)c2nccnc2C(=O)O)c1 |
| InChI | InChI=1S/C16H16N4O4/c1-20(2)12(21)9-10-4-3-5-11(8-10)19-15(22)13-14(16(23)24)18-7-6-17-13/h3-8H,9H2,1-2H3,(H,19,22)(H,23,24) |
| InChIKey | NZSXRELBLLDPCI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |