C21H20BrN3O2 — CID 56763638
2-(4-bromoindol-1-yl)-N-[1-(2-methoxyethyl)indol-4-yl]acetamide (PubChem CID 56763638) has the molecular formula C21H20BrN3O2 and a molecular weight of 426.31 g/mol. Its IUPAC name is 2-(4-bromoindol-1-yl)-N-[1-(2-methoxyethyl)indol-4-yl]acetamide.
| Compound Name | 2-(4-bromoindol-1-yl)-N-[1-(2-methoxyethyl)indol-4-yl]acetamide |
|---|---|
| PubChem CID | 56763638 |
| Molecular Formula | C21H20BrN3O2 |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 2-(4-bromoindol-1-yl)-N-[1-(2-methoxyethyl)indol-4-yl]acetamide |
| SMILES | COCCn1ccc2c(NC(=O)Cn3ccc4c(Br)cccc43)cccc21 |
| InChI | InChI=1S/C21H20BrN3O2/c1-27-13-12-24-10-9-16-18(5-3-7-20(16)24)23-21(26)14-25-11-8-15-17(22)4-2-6-19(15)25/h2-11H,12-14H2,1H3,(H,23,26) |
| InChIKey | PVYWVZUZFUIVJW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |