About 4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride
4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 56763825) has the molecular formula C7H14ClNO2
and a molecular weight of 179.65 g/mol. Its IUPAC name is 4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride |
| PubChem CID | 56763825 |
| Molecular Formula | C7H14ClNO2 |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | CC1(C)CNCC1C(=O)O.Cl |
| InChI | InChI=1S/C7H13NO2.ClH/c1-7(2)4-8-3-5(7)6(9)10;/h5,8H,3-4H2,1-2H3,(H,9,10);1H |
| InChIKey | BMXHOWOMKOCMKJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride?
The IUPAC name of 4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride (CID 56763825) is 4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride.
What is the SMILES notation for 4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride?
The canonical SMILES for 4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride is CC1(C)CNCC1C(=O)O.Cl.
What is the InChIKey of 4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride?
The InChIKey is BMXHOWOMKOCMKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.ClH/c1-7(2)4-8-3-5(7)6(9)10;/h5,8H,3-4H2,1-2H3,(H,9,10);1H.
What are the key properties of 4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride?
4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride has a molecular weight of 179.65 g/mol, XLogP of 0.74, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethylpyrrolidine-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 56763825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).